diff options
author | Navan Chauhan <navanchauhan@gmail.com> | 2020-11-08 15:16:44 +0530 |
---|---|---|
committer | Navan Chauhan <navanchauhan@gmail.com> | 2020-11-08 15:16:44 +0530 |
commit | 2c8b5955e452f60c3d78c5d4477fbdf78d002dcc (patch) | |
tree | 200cb558a842bf26f3cb94ff767f08ee7331c2ea /tests/test-oddt-plip.py | |
parent | f358f3d1dd816f0f30ee82450fc5234cea86ff56 (diff) |
added another action to test
Diffstat (limited to 'tests/test-oddt-plip.py')
-rw-r--r-- | tests/test-oddt-plip.py | 35 |
1 files changed, 35 insertions, 0 deletions
diff --git a/tests/test-oddt-plip.py b/tests/test-oddt-plip.py new file mode 100644 index 0000000..b993516 --- /dev/null +++ b/tests/test-oddt-plip.py @@ -0,0 +1,35 @@ +from plip.basic import config +from plip.exchange.webservices import fetch_pdb +from plip.structure.preparation import create_folder_if_not_exists, extract_pdbid +from plip.structure.preparation import tilde_expansion, PDBComplex + +pdbId = "6LU7" +print("Downloading PDB:",pdbId) + +pdbfile, pdbid = fetch_pdb(pdbId.lower()) + +pdbpath = tilde_expansion('%s/%s.pdb' % (config.BASEPATH.rstrip('/'), pdbid)) +create_folder_if_not_exists(config.BASEPATH) +with open(pdbpath, 'w') as g: + g.write(pdbfile) + +print("Adding Charges") +import oddt +from oddt.docking.AutodockVina import write_vina_pdbqt +receptor = next(oddt.toolkit.readfile("pdb",pdbpath.split("./")[1])) +receptor.calccharges() +#receptor = next(oddt.toolkits.rdk.readfile("pdb",pdbpath.split("./")[1])) +#receptor.calccharges() + +print("Writing PDBQT") +path = write_vina_pdbqt(receptor,'.',flexible=False) + +smiles = 'CCC(CC)COC(=O)C(C)NP(=O)(OCC1C(C(C(O1)(C#N)C2=CC=C3N2N=CN=C3N)O)O)OC4=CC=CC=C4' + +print("Generating Strucutre") +mol = oddt.toolkit.readstring('smi', smiles) +mol.make3D() +print("Adding Charges") +mol.calccharges() + +path2 = write_vina_pdbqt(mol,'.',flexible=False)
\ No newline at end of file |